C26H16O6 — CID 23628950
7,9-dihydroxy-2,2-diphenyl-[1,3]dioxolo[4,5-c]xanthen-6-one (PubChem CID 23628950) has the molecular formula C26H16O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 7,9-dihydroxy-2,2-diphenyl-[1,3]dioxolo[4,5-c]xanthen-6-one.
| Compound Name | 7,9-dihydroxy-2,2-diphenyl-[1,3]dioxolo[4,5-c]xanthen-6-one |
|---|---|
| PubChem CID | 23628950 |
| Molecular Formula | C26H16O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 7,9-dihydroxy-2,2-diphenyl-[1,3]dioxolo[4,5-c]xanthen-6-one |
| SMILES | O=c1c2ccc3c(c2oc2cc(O)cc(O)c12)OC(c1ccccc1)(c1ccccc1)O3 |
| InChI | InChI=1S/C26H16O6/c27-17-13-19(28)22-21(14-17)30-24-18(23(22)29)11-12-20-25(24)32-26(31-20,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,27-28H |
| InChIKey | NWGXSMVVLGPHFC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|