C28H18O6 — CID 125350333
2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5,7-dihydroxychromen-4-one (PubChem CID 125350333) has the molecular formula C28H18O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5,7-dihydroxychromen-4-one.
| Compound Name | 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 125350333 |
| Molecular Formula | C28H18O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5,7-dihydroxychromen-4-one |
| SMILES | O=c1cc(-c2ccc3c(c2)OC(c2ccccc2)(c2ccccc2)O3)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C28H18O6/c29-20-14-21(30)27-22(31)16-24(32-26(27)15-20)17-11-12-23-25(13-17)34-28(33-23,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-16,29-30H |
| InChIKey | LXZNQTVZNYMKOZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |