C17H16O6 — CID 162742274
anisole;3,5,7-trihydroxy-2-methylchromen-4-one (PubChem CID 162742274) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is anisole;3,5,7-trihydroxy-2-methylchromen-4-one.
| Compound Name | anisole;3,5,7-trihydroxy-2-methylchromen-4-one |
|---|---|
| PubChem CID | 162742274 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | anisole;3,5,7-trihydroxy-2-methylchromen-4-one |
| SMILES | COc1ccccc1.Cc1oc2cc(O)cc(O)c2c(=O)c1O |
| InChI | InChI=1S/C10H8O5.C7H8O/c1-4-9(13)10(14)8-6(12)2-5(11)3-7(8)15-4;1-8-7-5-3-2-4-6-7/h2-3,11-13H,1H3;2-6H,1H3 |
| InChIKey | PGJQTRPWGYQRGW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |