C21H22N2O5 — CID 174612862
5,7-dihydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]-4-methylchromen-2-one (PubChem CID 174612862) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5,7-dihydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]-4-methylchromen-2-one.
| Compound Name | 5,7-dihydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 174612862 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5,7-dihydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]-4-methylchromen-2-one |
| SMILES | COc1cccc(N2CCN(c3c(C)c4c(O)cc(O)cc4oc3=O)CC2)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-13-19-17(25)11-15(24)12-18(19)28-21(26)20(13)23-8-6-22(7-9-23)14-4-3-5-16(10-14)27-2/h3-5,10-12,24-25H,6-9H2,1-2H3 |
| InChIKey | FIVFEPYGTJAGNL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|