C15H11ClO5 — CID 14992078
2-chloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one (PubChem CID 14992078) has the molecular formula C15H11ClO5 and a molecular weight of 306.70 g/mol. Its IUPAC name is 2-chloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one.
| Compound Name | 2-chloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one |
|---|---|
| PubChem CID | 14992078 |
| Molecular Formula | C15H11ClO5 |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-chloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one |
| SMILES | COc1cc2oc3cc(O)cc(O)c3c(=O)c2c(C)c1Cl |
| InChI | InChI=1S/C15H11ClO5/c1-6-12-10(5-11(20-2)14(6)16)21-9-4-7(17)3-8(18)13(9)15(12)19/h3-5,17-18H,1-2H3 |
| InChIKey | LZGYVQLUSTUFAZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|