C17H13NO9 — CID 91016864
5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-nitrochromen-4-one (PubChem CID 91016864) has the molecular formula C17H13NO9 and a molecular weight of 375.29 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-nitrochromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-nitrochromen-4-one |
|---|---|
| PubChem CID | 91016864 |
| Molecular Formula | C17H13NO9 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-nitrochromen-4-one |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2[N+](=O)[O-])cc(OC)c1O |
| InChI | InChI=1S/C17H13NO9/c1-25-11-3-7(4-12(26-2)15(11)21)17-14(18(23)24)16(22)13-9(20)5-8(19)6-10(13)27-17/h3-6,19-21H,1-2H3 |
| InChIKey | DJOVLUFXOCOLQM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|