C15H10Cl2O5 — CID 14992081
2,5-dichloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one (PubChem CID 14992081) has the molecular formula C15H10Cl2O5 and a molecular weight of 341.15 g/mol. Its IUPAC name is 2,5-dichloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one.
| Compound Name | 2,5-dichloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one |
|---|---|
| PubChem CID | 14992081 |
| Molecular Formula | C15H10Cl2O5 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2,5-dichloro-6,8-dihydroxy-3-methoxy-1-methylxanthen-9-one |
| SMILES | COc1cc2oc3c(Cl)c(O)cc(O)c3c(=O)c2c(C)c1Cl |
| InChI | InChI=1S/C15H10Cl2O5/c1-5-10-8(4-9(21-2)12(5)16)22-15-11(14(10)20)6(18)3-7(19)13(15)17/h3-4,18-19H,1-2H3 |
| InChIKey | XJYANNUGMVTZOD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|