C16H10O8 — CID 163073000
5,13-dihydroxy-6,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione (PubChem CID 163073000) has the molecular formula C16H10O8 and a molecular weight of 330.25 g/mol. Its IUPAC name is 5,13-dihydroxy-6,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione.
| Compound Name | 5,13-dihydroxy-6,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione |
|---|---|
| PubChem CID | 163073000 |
| Molecular Formula | C16H10O8 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 5,13-dihydroxy-6,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione |
| SMILES | COc1cc2oc(=O)c3cc(O)c(OC)c4oc(=O)c(c1O)c2c43 |
| InChI | InChI=1S/C16H10O8/c1-21-8-4-7-10-9-5(15(19)23-7)3-6(17)13(22-2)14(9)24-16(20)11(10)12(8)18/h3-4,17-18H,1-2H3 |
| InChIKey | LYQKFMPSKZLVMJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|