C16H10O5 — CID 11737608
6,13-dihydroxy-7-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),9,11,13-heptaen-3-one (PubChem CID 11737608) has the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. Its IUPAC name is 6,13-dihydroxy-7-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),9,11,13-heptaen-3-one.
| Compound Name | 6,13-dihydroxy-7-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),9,11,13-heptaen-3-one |
|---|---|
| PubChem CID | 11737608 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 6,13-dihydroxy-7-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),9,11,13-heptaen-3-one |
| SMILES | COc1c(O)cc2c(=O)oc3cc(O)cc4ccc1c2c43 |
| InChI | InChI=1S/C16H10O5/c1-20-15-9-3-2-7-4-8(17)5-12-13(7)14(9)10(6-11(15)18)16(19)21-12/h2-6,17-18H,1H3 |
| InChIKey | FHMVNGNRHMPWOI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|