C12H7BrO5 — CID 54718203
6-bromo-5-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 54718203) has the molecular formula C12H7BrO5 and a molecular weight of 311.09 g/mol. Its IUPAC name is 6-bromo-5-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 6-bromo-5-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 54718203 |
| Molecular Formula | C12H7BrO5 |
| Molecular Weight | 311.09 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | 6-bromo-5-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2ccoc2cc2oc(=O)c(Br)c(O)c12 |
| InChI | InChI=1S/C12H7BrO5/c1-16-11-5-2-3-17-6(5)4-7-8(11)10(14)9(13)12(15)18-7/h2-4,14H,1H3 |
| InChIKey | FHGSEEXCWZIHHQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.09 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|