C12H8O6S — CID 101182134
4-methoxy-5-oxofuro[3,2-g]chromene-6-sulfinic acid (PubChem CID 101182134) has the molecular formula C12H8O6S and a molecular weight of 280.26 g/mol. Its IUPAC name is 4-methoxy-5-oxofuro[3,2-g]chromene-6-sulfinic acid.
| Compound Name | 4-methoxy-5-oxofuro[3,2-g]chromene-6-sulfinic acid |
|---|---|
| PubChem CID | 101182134 |
| Molecular Formula | C12H8O6S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 4-methoxy-5-oxofuro[3,2-g]chromene-6-sulfinic acid |
| SMILES | COc1c2ccoc2cc2occ(S(=O)O)c(=O)c12 |
| InChI | InChI=1S/C12H8O6S/c1-16-12-6-2-3-17-7(6)4-8-10(12)11(13)9(5-18-8)19(14)15/h2-5H,1H3,(H,14,15) |
| InChIKey | HVMWFOSXDHBGAQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|