C15H12O4S2 — CID 91495761
6-(1,3-dithiolan-2-yl)-4-methoxyfuro[3,2-g]chromen-5-one (PubChem CID 91495761) has the molecular formula C15H12O4S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 6-(1,3-dithiolan-2-yl)-4-methoxyfuro[3,2-g]chromen-5-one.
| Compound Name | 6-(1,3-dithiolan-2-yl)-4-methoxyfuro[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 91495761 |
| Molecular Formula | C15H12O4S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 6-(1,3-dithiolan-2-yl)-4-methoxyfuro[3,2-g]chromen-5-one |
| SMILES | COc1c2ccoc2cc2occ(C3SCCS3)c(=O)c12 |
| InChI | InChI=1S/C15H12O4S2/c1-17-14-8-2-3-18-10(8)6-11-12(14)13(16)9(7-19-11)15-20-4-5-21-15/h2-3,6-7,15H,4-5H2,1H3 |
| InChIKey | QYROUSJKJLKHAA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |