C14H12O6 — CID 623929
4,5,6-trimethoxyfuro[3,2-g]chromen-7-one (PubChem CID 623929) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is 4,5,6-trimethoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 4,5,6-trimethoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 623929 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4,5,6-trimethoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c(OC)c2c(OC)c3ccoc3cc2oc1=O |
| InChI | InChI=1S/C14H12O6/c1-16-11-7-4-5-19-8(7)6-9-10(11)12(17-2)13(18-3)14(15)20-9/h4-6H,1-3H3 |
| InChIKey | SHOQQSABOUVQLJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|