C12H8O5 — CID 131852892
4-hydroxy-3-methoxyfuro[2,3-h]chromen-2-one (PubChem CID 131852892) has the molecular formula C12H8O5 and a molecular weight of 232.19 g/mol. Its IUPAC name is 4-hydroxy-3-methoxyfuro[2,3-h]chromen-2-one.
| Compound Name | 4-hydroxy-3-methoxyfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 131852892 |
| Molecular Formula | C12H8O5 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 4-hydroxy-3-methoxyfuro[2,3-h]chromen-2-one |
| SMILES | COc1c(O)c2ccc3occc3c2oc1=O |
| InChI | InChI=1S/C12H8O5/c1-15-11-9(13)7-2-3-8-6(4-5-16-8)10(7)17-12(11)14/h2-5,13H,1H3 |
| InChIKey | DSXCMHXJPITNRC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|