C12H12O6 — CID 86221763
6-hydroxy-5,7,8-trimethoxychromen-2-one (PubChem CID 86221763) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 6-hydroxy-5,7,8-trimethoxychromen-2-one.
| Compound Name | 6-hydroxy-5,7,8-trimethoxychromen-2-one |
|---|---|
| PubChem CID | 86221763 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 6-hydroxy-5,7,8-trimethoxychromen-2-one |
| SMILES | COc1c(O)c(OC)c2ccc(=O)oc2c1OC |
| InChI | InChI=1S/C12H12O6/c1-15-9-6-4-5-7(13)18-10(6)12(17-3)11(16-2)8(9)14/h4-5,14H,1-3H3 |
| InChIKey | ANLOTPFPHVRUAQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|