C16H16O7 — CID 10403706
1,3,4,6-tetramethoxydibenzofuran-2,7-diol (PubChem CID 10403706) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is 1,3,4,6-tetramethoxydibenzofuran-2,7-diol.
| Compound Name | 1,3,4,6-tetramethoxydibenzofuran-2,7-diol |
|---|---|
| PubChem CID | 10403706 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1,3,4,6-tetramethoxydibenzofuran-2,7-diol |
| SMILES | COc1c(O)c(OC)c2c(oc3c(OC)c(O)ccc32)c1OC |
| InChI | InChI=1S/C16H16O7/c1-19-12-8(17)6-5-7-9-13(20-2)10(18)15(21-3)16(22-4)14(9)23-11(7)12/h5-6,17-18H,1-4H3 |
| InChIKey | QPJPNKHHNVCLCF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |