C15H16O5 — CID 143290576
ethane;4-hydroxy-9-methoxy-7-methylfuro[3,2-g]chromen-5-one (PubChem CID 143290576) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is ethane;4-hydroxy-9-methoxy-7-methylfuro[3,2-g]chromen-5-one.
| Compound Name | ethane;4-hydroxy-9-methoxy-7-methylfuro[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 143290576 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | ethane;4-hydroxy-9-methoxy-7-methylfuro[3,2-g]chromen-5-one |
| SMILES | CC.COc1c2occc2c(O)c2c(=O)cc(C)oc12 |
| InChI | InChI=1S/C13H10O5.C2H6/c1-6-5-8(14)9-10(15)7-3-4-17-11(7)13(16-2)12(9)18-6;1-2/h3-5,15H,1-2H3;1-2H3 |
| InChIKey | IJSFMSPMMJRBPL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |