About 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one
5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one (PubChem CID 14482774) has the molecular formula C12H12O5
and a molecular weight of 236.22 g/mol. Its IUPAC name is 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one.
Molecular Properties
| Compound Name | 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one |
| PubChem CID | 14482774 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one |
| SMILES | COc1c(O)c(C)c2oc(C)cc(=O)c2c1O |
| InChI | InChI=1S/C12H12O5/c1-5-4-7(13)8-10(15)12(16-3)9(14)6(2)11(8)17-5/h4,14-15H,1-3H3 |
| InChIKey | PRGZBQOFSHAQEK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one?
The IUPAC name of 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one (CID 14482774) is 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one.
What is the SMILES notation for 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one?
The canonical SMILES for 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one is COc1c(O)c(C)c2oc(C)cc(=O)c2c1O.
What is the InChIKey of 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one?
The InChIKey is PRGZBQOFSHAQEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O5/c1-5-4-7(13)8-10(15)12(16-3)9(14)6(2)11(8)17-5/h4,14-15H,1-3H3.
What are the key properties of 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one?
5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one has a molecular weight of 236.22 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroxy-6-methoxy-2,8-dimethylchromen-4-one is sourced from PubChem (CID 14482774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).