C31H24O10 — CID 135849817
4,5-dihydroxy-10-(5-hydroxy-6,8-dimethoxy-2-methyl-4-oxobenzo[g]chromen-10-yl)-6-methoxy-2-methylbenzo[g]chromen-8-one (PubChem CID 135849817) has the molecular formula C31H24O10 and a molecular weight of 556.52 g/mol. Its IUPAC name is 4,5-dihydroxy-10-(5-hydroxy-6,8-dimethoxy-2-methyl-4-oxobenzo[g]chromen-10-yl)-6-methoxy-2-methylbenzo[g]chromen-8-one.
| Compound Name | 4,5-dihydroxy-10-(5-hydroxy-6,8-dimethoxy-2-methyl-4-oxobenzo[g]chromen-10-yl)-6-methoxy-2-methylbenzo[g]chromen-8-one |
|---|---|
| PubChem CID | 135849817 |
| Molecular Formula | C31H24O10 |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 4,5-dihydroxy-10-(5-hydroxy-6,8-dimethoxy-2-methyl-4-oxobenzo[g]chromen-10-yl)-6-methoxy-2-methylbenzo[g]chromen-8-one |
| SMILES | COc1cc(OC)c2c(O)c3c(=O)cc(C)oc3c(-c3c4cc(=O)cc(OC)c4c(O)c4c(O)cc(C)oc34)c2c1 |
| InChI | InChI=1S/C31H24O10/c1-12-6-18(33)26-28(35)22-16(8-14(32)9-20(22)38-4)24(30(26)40-12)25-17-10-15(37-3)11-21(39-5)23(17)29(36)27-19(34)7-13(2)41-31(25)27/h6-11,33,35-36H,1-5H3 |
| InChIKey | OYYJLLGUBCSGDS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 148.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|