C14H14O5 — CID 143290579
4,9-dihydroxy-7-methylfuro[3,2-g]chromen-5-one;ethane (PubChem CID 143290579) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4,9-dihydroxy-7-methylfuro[3,2-g]chromen-5-one;ethane.
| Compound Name | 4,9-dihydroxy-7-methylfuro[3,2-g]chromen-5-one;ethane |
|---|---|
| PubChem CID | 143290579 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4,9-dihydroxy-7-methylfuro[3,2-g]chromen-5-one;ethane |
| SMILES | CC.Cc1cc(=O)c2c(O)c3ccoc3c(O)c2o1 |
| InChI | InChI=1S/C12H8O5.C2H6/c1-5-4-7(13)8-9(14)6-2-3-16-11(6)10(15)12(8)17-5;1-2/h2-4,14-15H,1H3;1-2H3 |
| InChIKey | NVMAEDRPRXPOPF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|