C20H16O5 — CID 11537346
9-methoxy-7-methyl-4-phenylmethoxyfuro[3,2-g]chromen-5-one (PubChem CID 11537346) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is 9-methoxy-7-methyl-4-phenylmethoxyfuro[3,2-g]chromen-5-one.
| Compound Name | 9-methoxy-7-methyl-4-phenylmethoxyfuro[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 11537346 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 9-methoxy-7-methyl-4-phenylmethoxyfuro[3,2-g]chromen-5-one |
| SMILES | COc1c2occc2c(OCc2ccccc2)c2c(=O)cc(C)oc12 |
| InChI | InChI=1S/C20H16O5/c1-12-10-15(21)16-17(24-11-13-6-4-3-5-7-13)14-8-9-23-18(14)20(22-2)19(16)25-12/h3-10H,11H2,1-2H3 |
| InChIKey | GVVWHZPQEQHLQG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |