C13H12O3 — CID 1490119
2-methyl-3-phenylmethoxypyran-4-one (PubChem CID 1490119) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-methyl-3-phenylmethoxypyran-4-one.
| Compound Name | 2-methyl-3-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 1490119 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-methyl-3-phenylmethoxypyran-4-one |
| SMILES | Cc1occc(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C13H12O3/c1-10-13(12(14)7-8-15-10)16-9-11-5-3-2-4-6-11/h2-8H,9H2,1H3 |
| InChIKey | LQDVCPYRCOKNMV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |