C17H14O4S — CID 21474413
2-[hydroxy(thiophen-2-yl)methyl]-3-phenylmethoxypyran-4-one (PubChem CID 21474413) has the molecular formula C17H14O4S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-[hydroxy(thiophen-2-yl)methyl]-3-phenylmethoxypyran-4-one.
| Compound Name | 2-[hydroxy(thiophen-2-yl)methyl]-3-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 21474413 |
| Molecular Formula | C17H14O4S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[hydroxy(thiophen-2-yl)methyl]-3-phenylmethoxypyran-4-one |
| SMILES | O=c1ccoc(C(O)c2cccs2)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H14O4S/c18-13-8-9-20-17(15(19)14-7-4-10-22-14)16(13)21-11-12-5-2-1-3-6-12/h1-10,15,19H,11H2 |
| InChIKey | PIUATICZLHNQMA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |