C14H12F2O4 — CID 145480651
6-(difluoromethyl)-2-(hydroxymethyl)-3-phenylmethoxypyran-4-one (PubChem CID 145480651) has the molecular formula C14H12F2O4 and a molecular weight of 282.24 g/mol. Its IUPAC name is 6-(difluoromethyl)-2-(hydroxymethyl)-3-phenylmethoxypyran-4-one.
| Compound Name | 6-(difluoromethyl)-2-(hydroxymethyl)-3-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 145480651 |
| Molecular Formula | C14H12F2O4 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6-(difluoromethyl)-2-(hydroxymethyl)-3-phenylmethoxypyran-4-one |
| SMILES | O=c1cc(C(F)F)oc(CO)c1OCc1ccccc1 |
| InChI | InChI=1S/C14H12F2O4/c15-14(16)11-6-10(18)13(12(7-17)20-11)19-8-9-4-2-1-3-5-9/h1-6,14,17H,7-8H2 |
| InChIKey | UXTCMJWWAOFEMH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |