C22H23NO3 — CID 156776484
2-(hydroxymethyl)-6-methyl-1-(2-phenylethyl)-3-phenylmethoxypyridin-4-one (PubChem CID 156776484) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-methyl-1-(2-phenylethyl)-3-phenylmethoxypyridin-4-one.
| Compound Name | 2-(hydroxymethyl)-6-methyl-1-(2-phenylethyl)-3-phenylmethoxypyridin-4-one |
|---|---|
| PubChem CID | 156776484 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-(hydroxymethyl)-6-methyl-1-(2-phenylethyl)-3-phenylmethoxypyridin-4-one |
| SMILES | Cc1cc(=O)c(OCc2ccccc2)c(CO)n1CCc1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-17-14-21(25)22(26-16-19-10-6-3-7-11-19)20(15-24)23(17)13-12-18-8-4-2-5-9-18/h2-11,14,24H,12-13,15-16H2,1H3 |
| InChIKey | VFOAABFZEWEEPK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |