C14H14O5 — CID 18428308
2,6-bis(hydroxymethyl)-3-phenylmethoxypyran-4-one (PubChem CID 18428308) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)-3-phenylmethoxypyran-4-one.
| Compound Name | 2,6-bis(hydroxymethyl)-3-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 18428308 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2,6-bis(hydroxymethyl)-3-phenylmethoxypyran-4-one |
| SMILES | O=c1cc(CO)oc(CO)c1OCc1ccccc1 |
| InChI | InChI=1S/C14H14O5/c15-7-11-6-12(17)14(13(8-16)19-11)18-9-10-4-2-1-3-5-10/h1-6,15-16H,7-9H2 |
| InChIKey | HQATWDFDKRORFO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |