C28H23F2N3O4S — CID 171784686
(3R)-2-[(3,4-difluorophenyl)-thiophen-2-ylmethyl]-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 171784686) has the molecular formula C28H23F2N3O4S and a molecular weight of 535.57 g/mol. Its IUPAC name is (3R)-2-[(3,4-difluorophenyl)-thiophen-2-ylmethyl]-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-2-[(3,4-difluorophenyl)-thiophen-2-ylmethyl]-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 171784686 |
| Molecular Formula | C28H23F2N3O4S |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | (3R)-2-[(3,4-difluorophenyl)-thiophen-2-ylmethyl]-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N(C(c2ccc(F)c(F)c2)c2cccs2)[C@@H]2COCCN12 |
| InChI | InChI=1S/C28H23F2N3O4S/c29-20-9-8-19(15-21(20)30)25(23-7-4-14-38-23)33-24-17-36-13-12-31(24)28(35)26-27(22(34)10-11-32(26)33)37-16-18-5-2-1-3-6-18/h1-11,14-15,24-25H,12-13,16-17H2/t24-,25?/m1/s1 |
| InChIKey | HMQWQDGELFEBLV-IKOFQBKESA-N |
| XLogP | 4.31 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |