C33H31N3O4S — CID 145179433
acetylene;6,11-dihydrobenzo[c][1]benzothiepine;(3R)-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 145179433) has the molecular formula C33H31N3O4S and a molecular weight of 565.70 g/mol. Its IUPAC name is acetylene;6,11-dihydrobenzo[c][1]benzothiepine;(3R)-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | acetylene;6,11-dihydrobenzo[c][1]benzothiepine;(3R)-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 145179433 |
| Molecular Formula | C33H31N3O4S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | acetylene;6,11-dihydrobenzo[c][1]benzothiepine;(3R)-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | C#C.O=C1c2c(OCc3ccccc3)c(=O)ccn2N[C@@H]2COCCN12.c1ccc2c(c1)CSc1ccccc1C2 |
| InChI | InChI=1S/C17H17N3O4.C14H12S.C2H2/c21-13-6-7-20-15(16(13)24-10-12-4-2-1-3-5-12)17(22)19-8-9-23-11-14(19)18-20;1-2-7-13-10-15-14-8-4-3-6-12(14)9-11(13)5-1;1-2/h1-7,14,18H,8-11H2;1-8H,9-10H2;1-2H/t14-;;/m0../s1 |
| InChIKey | BMNDYEAEVQHOAD-UTLKBRERSA-N |
| XLogP | 4.92 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|