C21H23N3O4 — CID 171633632
10-phenylmethoxyspiro[1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-5,4'-oxane]-8,11-dione (PubChem CID 171633632) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 10-phenylmethoxyspiro[1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-5,4'-oxane]-8,11-dione.
| Compound Name | 10-phenylmethoxyspiro[1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-5,4'-oxane]-8,11-dione |
|---|---|
| PubChem CID | 171633632 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 10-phenylmethoxyspiro[1,2,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-5,4'-oxane]-8,11-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2NC2CC3(CCOCC3)CN12 |
| InChI | InChI=1S/C21H23N3O4/c25-16-6-9-24-18(19(16)28-13-15-4-2-1-3-5-15)20(26)23-14-21(12-17(23)22-24)7-10-27-11-8-21/h1-6,9,17,22H,7-8,10-14H2 |
| InChIKey | HCEHJBDIOMEECJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |