C17H17N3O3Se — CID 170680784
(3R)-11-phenylmethoxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 170680784) has the molecular formula C17H17N3O3Se and a molecular weight of 390.30 g/mol. Its IUPAC name is (3R)-11-phenylmethoxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-11-phenylmethoxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 170680784 |
| Molecular Formula | C17H17N3O3Se |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | (3R)-11-phenylmethoxy-5-selena-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N[C@@H]2C[Se]CCN12 |
| InChI | InChI=1S/C17H17N3O3Se/c21-13-6-7-20-15(16(13)23-10-12-4-2-1-3-5-12)17(22)19-8-9-24-11-14(19)18-20/h1-7,14,18H,8-11H2/t14-/m0/s1 |
| InChIKey | MZEJEWGKPKZLPW-AWEZNQCLSA-N |
| XLogP | 1.31 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|