C18H18N4O6 — CID 134319067
(4-aminophenyl)methyl (9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl) carbonate (PubChem CID 134319067) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is (4-aminophenyl)methyl (9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl) carbonate.
| Compound Name | (4-aminophenyl)methyl (9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl) carbonate |
|---|---|
| PubChem CID | 134319067 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (4-aminophenyl)methyl (9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl) carbonate |
| SMILES | Nc1ccc(COC(=O)Oc2c3n(ccc2=O)NC2COCCN2C3=O)cc1 |
| InChI | InChI=1S/C18H18N4O6/c19-12-3-1-11(2-4-12)9-27-18(25)28-16-13(23)5-6-22-15(16)17(24)21-7-8-26-10-14(21)20-22/h1-6,14,20H,7-10,19H2 |
| InChIKey | QVUFUKRSQCBLNJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|