C32H26F2N4O6S — CID 134470806
(4-aminophenyl)methyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] carbonate (PubChem CID 134470806) has the molecular formula C32H26F2N4O6S and a molecular weight of 632.65 g/mol. Its IUPAC name is (4-aminophenyl)methyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] carbonate.
| Compound Name | (4-aminophenyl)methyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] carbonate |
|---|---|
| PubChem CID | 134470806 |
| Molecular Formula | C32H26F2N4O6S |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | (4-aminophenyl)methyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] carbonate |
| SMILES | Nc1ccc(COC(=O)Oc2c3n(ccc2=O)N([C@@H]2c4ccccc4SCc4c2ccc(F)c4F)[C@@H]2COCCN2C3=O)cc1 |
| InChI | InChI=1S/C32H26F2N4O6S/c33-23-10-9-20-22(27(23)34)17-45-25-4-2-1-3-21(25)28(20)38-26-16-42-14-13-36(26)31(40)29-30(24(39)11-12-37(29)38)44-32(41)43-15-18-5-7-19(35)8-6-18/h1-12,26,28H,13-17,35H2/t26-,28+/m1/s1 |
| InChIKey | CLIDXXXKIIKUFP-IAPPQJPRSA-N |
| XLogP | 4.57 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|