C30H29F2N3O7S — CID 134464756
tert-butyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl carbonate (PubChem CID 134464756) has the molecular formula C30H29F2N3O7S and a molecular weight of 613.64 g/mol. Its IUPAC name is tert-butyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl carbonate.
| Compound Name | tert-butyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl carbonate |
|---|---|
| PubChem CID | 134464756 |
| Molecular Formula | C30H29F2N3O7S |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | tert-butyl [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3ccccc3SCc3c1ccc(F)c3F)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C30H29F2N3O7S/c1-30(2,3)42-29(38)41-16-40-27-21(36)10-11-34-26(27)28(37)33-12-13-39-14-23(33)35(34)25-17-8-9-20(31)24(32)19(17)15-43-22-7-5-4-6-18(22)25/h4-11,23,25H,12-16H2,1-3H3/t23-,25+/m1/s1 |
| InChIKey | WBBSDTNONICGSB-NOZRDPDXSA-N |
| XLogP | 4.56 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|