C28H25F2N3O8S — CID 153289727
[(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(hydroxymethyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 153289727) has the molecular formula C28H25F2N3O8S and a molecular weight of 601.58 g/mol. Its IUPAC name is [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(hydroxymethyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(hydroxymethyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 153289727 |
| Molecular Formula | C28H25F2N3O8S |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-6-(hydroxymethyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3ccccc3SCc3c1ccc(F)c3F)[C@@H]1COC(CO)CN1C2=O |
| InChI | InChI=1S/C28H25F2N3O8S/c1-38-28(37)41-14-40-26-20(35)8-9-32-25(26)27(36)31-10-15(11-34)39-12-22(31)33(32)24-16-6-7-19(29)23(30)18(16)13-42-21-5-3-2-4-17(21)24/h2-9,15,22,24,34H,10-14H2,1H3/t15?,22-,24+/m1/s1 |
| InChIKey | OFVMWUBNHSUXAD-DTERAVRUSA-N |
| XLogP | 2.75 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|