C27H22BrF2N3O7S — CID 162711272
[(3R)-13-bromo-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 162711272) has the molecular formula C27H22BrF2N3O7S and a molecular weight of 650.45 g/mol. Its IUPAC name is [(3R)-13-bromo-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R)-13-bromo-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 162711272 |
| Molecular Formula | C27H22BrF2N3O7S |
| Molecular Weight | 650.45 g/mol |
| Exact Mass | 649.03 |
| IUPAC Name | [(3R)-13-bromo-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(cc(Br)c1=O)N(C1c3ccccc3SCc3c1ccc(F)c3F)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C27H22BrF2N3O7S/c1-37-27(36)40-13-39-25-23-26(35)31-8-9-38-11-20(31)33(32(23)10-17(28)24(25)34)22-14-6-7-18(29)21(30)16(14)12-41-19-5-3-2-4-15(19)22/h2-7,10,20,22H,8-9,11-13H2,1H3/t20-,22?/m1/s1 |
| InChIKey | HQHXDVILYXMVDO-PSDZMVHGSA-N |
| XLogP | 4.15 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|