C31H29F2N3O7S — CID 138482094
[2-(8,9-difluoro-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepin-12-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 138482094) has the molecular formula C31H29F2N3O7S and a molecular weight of 625.65 g/mol. Its IUPAC name is [2-(8,9-difluoro-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepin-12-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [2-(8,9-difluoro-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepin-12-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 138482094 |
| Molecular Formula | C31H29F2N3O7S |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.17 |
| IUPAC Name | [2-(8,9-difluoro-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepin-12-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N(C1c3cc4c(cc3SCc3c1ccc(F)c3F)CCCC4)C1COCCN1C2=O |
| InChI | InChI=1S/C31H29F2N3O7S/c1-40-31(39)43-16-42-29-23(37)8-9-35-28(29)30(38)34-10-11-41-14-25(34)36(35)27-19-6-7-22(32)26(33)21(19)15-44-24-13-18-5-3-2-4-17(18)12-20(24)27/h6-9,12-13,25,27H,2-5,10-11,14-16H2,1H3 |
| InChIKey | DMWZHWZWQBDHCV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|