C30H28F2N4O7 — CID 138482195
[(3R)-2-[(11S)-5-cyclopropyl-7,8-difluoro-6,11-dihydrobenzo[c][1]benzazepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 138482195) has the molecular formula C30H28F2N4O7 and a molecular weight of 594.57 g/mol. Its IUPAC name is [(3R)-2-[(11S)-5-cyclopropyl-7,8-difluoro-6,11-dihydrobenzo[c][1]benzazepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R)-2-[(11S)-5-cyclopropyl-7,8-difluoro-6,11-dihydrobenzo[c][1]benzazepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 138482195 |
| Molecular Formula | C30H28F2N4O7 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | [(3R)-2-[(11S)-5-cyclopropyl-7,8-difluoro-6,11-dihydrobenzo[c][1]benzazepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3ccccc3N(C3CC3)Cc3c1ccc(F)c3F)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C30H28F2N4O7/c1-40-30(39)43-16-42-28-23(37)10-11-35-27(28)29(38)33-12-13-41-15-24(33)36(35)26-18-8-9-21(31)25(32)20(18)14-34(17-6-7-17)22-5-3-2-4-19(22)26/h2-5,8-11,17,24,26H,6-7,12-16H2,1H3/t24-,26+/m1/s1 |
| InChIKey | SJFCBMSSGCAARB-RSXGOPAZSA-N |
| XLogP | 3.27 |
| TPSA | 102.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|