C27H23F2N3O6Se — CID 162711268
[(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzoselenepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl acetate (PubChem CID 162711268) has the molecular formula C27H23F2N3O6Se and a molecular weight of 602.45 g/mol. Its IUPAC name is [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzoselenepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl acetate.
| Compound Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzoselenepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl acetate |
|---|---|
| PubChem CID | 162711268 |
| Molecular Formula | C27H23F2N3O6Se |
| Molecular Weight | 602.45 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzoselenepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl acetate |
| SMILES | CC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3ccccc3[Se]Cc3c1ccc(F)c3F)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C27H23F2N3O6Se/c1-15(33)37-14-38-26-20(34)8-9-31-25(26)27(35)30-10-11-36-12-22(30)32(31)24-16-6-7-19(28)23(29)18(16)13-39-21-5-3-2-4-17(21)24/h2-9,22,24H,10-14H2,1H3/t22-,24+/m1/s1 |
| InChIKey | JBCDKVOOVXBXMK-VWNXMTODSA-N |
| XLogP | 1.41 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|