C30H34F2N4O7 — CID 155104825
[2-[(2R,12R)-7,8-difluoro-11-methyl-11-azatetracyclo[11.2.2.02,12.04,9]heptadeca-4(9),5,7-trien-3-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 155104825) has the molecular formula C30H34F2N4O7 and a molecular weight of 600.62 g/mol. Its IUPAC name is [2-[(2R,12R)-7,8-difluoro-11-methyl-11-azatetracyclo[11.2.2.02,12.04,9]heptadeca-4(9),5,7-trien-3-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [2-[(2R,12R)-7,8-difluoro-11-methyl-11-azatetracyclo[11.2.2.02,12.04,9]heptadeca-4(9),5,7-trien-3-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 155104825 |
| Molecular Formula | C30H34F2N4O7 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | [2-[(2R,12R)-7,8-difluoro-11-methyl-11-azatetracyclo[11.2.2.02,12.04,9]heptadeca-4(9),5,7-trien-3-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N(C1c3ccc(F)c(F)c3CN(C)[C@@H]3C4CCC(CC4)[C@@H]13)C1COCCN1C2=O |
| InChI | InChI=1S/C30H34F2N4O7/c1-33-13-19-18(7-8-20(31)24(19)32)26(23-16-3-5-17(6-4-16)25(23)33)36-22-14-41-12-11-34(22)29(38)27-28(21(37)9-10-35(27)36)42-15-43-30(39)40-2/h7-10,16-17,22-23,25-26H,3-6,11-15H2,1-2H3/t16?,17?,22?,23-,25-,26?/m1/s1 |
| InChIKey | VWNIKVFFCFDQNT-PVZULGAASA-N |
| XLogP | 2.99 |
| TPSA | 102.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|