C32H33N3O7S — CID 155104858
[(3R)-9,12-dioxo-2-[(11S)-spiro[11H-benzo[c][1]benzothiepine-6,1'-cyclohexane]-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 155104858) has the molecular formula C32H33N3O7S and a molecular weight of 603.70 g/mol. Its IUPAC name is [(3R)-9,12-dioxo-2-[(11S)-spiro[11H-benzo[c][1]benzothiepine-6,1'-cyclohexane]-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R)-9,12-dioxo-2-[(11S)-spiro[11H-benzo[c][1]benzothiepine-6,1'-cyclohexane]-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 155104858 |
| Molecular Formula | C32H33N3O7S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | [(3R)-9,12-dioxo-2-[(11S)-spiro[11H-benzo[c][1]benzothiepine-6,1'-cyclohexane]-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3ccccc3SC3(CCCCC3)c3ccccc31)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C32H33N3O7S/c1-39-31(38)42-20-41-29-24(36)13-16-34-28(29)30(37)33-17-18-40-19-26(33)35(34)27-21-9-3-5-11-23(21)32(14-7-2-8-15-32)43-25-12-6-4-10-22(25)27/h3-6,9-13,16,26-27H,2,7-8,14-15,17-20H2,1H3/t26-,27+/m1/s1 |
| InChIKey | LLVGKDMNNWQIMD-SXOMAYOGSA-N |
| XLogP | 4.77 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|