C29H28FN3O8S — CID 134464659
[(3R)-2-[(11S)-10-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 134464659) has the molecular formula C29H28FN3O8S and a molecular weight of 597.62 g/mol. Its IUPAC name is [(3R)-2-[(11S)-10-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [(3R)-2-[(11S)-10-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 134464659 |
| Molecular Formula | C29H28FN3O8S |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | [(3R)-2-[(11S)-10-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3ccccc3SCc3cccc(F)c31)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C29H28FN3O8S/c1-37-13-14-39-29(36)41-17-40-27-21(34)9-10-32-26(27)28(35)31-11-12-38-15-23(31)33(32)25-19-6-2-3-8-22(19)42-16-18-5-4-7-20(30)24(18)25/h2-10,23,25H,11-17H2,1H3/t23-,25-/m1/s1 |
| InChIKey | BTLYESCAEMRMKY-ILBGXUMGSA-N |
| XLogP | 3.27 |
| TPSA | 108.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|