C32H27F2N3O9 — CID 138482340
[2-(8,9-difluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-13-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 138482340) has the molecular formula C32H27F2N3O9 and a molecular weight of 635.58 g/mol. Its IUPAC name is [2-(8,9-difluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-13-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [2-(8,9-difluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-13-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 138482340 |
| Molecular Formula | C32H27F2N3O9 |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.17 |
| IUPAC Name | [2-(8,9-difluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-13-yl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOc1c2n(ccc1=O)N(C1c3ccccc3-c3occc3-c3c1ccc(F)c3F)C1COCCN1C2=O |
| InChI | InChI=1S/C32H27F2N3O9/c1-41-14-15-44-32(40)46-17-45-30-23(38)8-10-36-28(30)31(39)35-11-13-42-16-24(35)37(36)27-18-4-2-3-5-19(18)29-21(9-12-43-29)25-20(27)6-7-22(33)26(25)34/h2-10,12,24,27H,11,13-17H2,1H3 |
| InChIKey | AIKZPJTZZLFWEI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 121.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|