C30H25N3O7S — CID 147339500
[9,12-dioxo-2-(3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-13-yl)-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 147339500) has the molecular formula C30H25N3O7S and a molecular weight of 571.61 g/mol. Its IUPAC name is [9,12-dioxo-2-(3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-13-yl)-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [9,12-dioxo-2-(3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-13-yl)-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 147339500 |
| Molecular Formula | C30H25N3O7S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | [9,12-dioxo-2-(3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-13-yl)-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N(C1c3ccccc3-c3ccsc3-c3ccccc31)C1COCCN1C2=O |
| InChI | InChI=1S/C30H25N3O7S/c1-37-30(36)40-17-39-27-23(34)10-12-32-26(27)29(35)31-13-14-38-16-24(31)33(32)25-19-7-3-2-6-18(19)22-11-15-41-28(22)21-9-5-4-8-20(21)25/h2-12,15,24-25H,13-14,16-17H2,1H3 |
| InChIKey | DDEVDWSVLKGFHH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|