C32H29F2N3O6S — CID 155705308
[(3R,5Z)-5-[(Z)-but-2-enylidene]-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 155705308) has the molecular formula C32H29F2N3O6S and a molecular weight of 621.66 g/mol. Its IUPAC name is [(3R,5Z)-5-[(Z)-but-2-enylidene]-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R,5Z)-5-[(Z)-but-2-enylidene]-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 155705308 |
| Molecular Formula | C32H29F2N3O6S |
| Molecular Weight | 621.66 g/mol |
| Exact Mass | 621.17 |
| IUPAC Name | [(3R,5Z)-5-[(Z)-but-2-enylidene]-2-(7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | C/C=C\C=C1\CCN2C(=O)c3c(OCOC(=O)OC)c(=O)ccn3N(C3c4ccccc4SCc4c3ccc(F)c4F)[C@@H]2C1 |
| InChI | InChI=1S/C32H29F2N3O6S/c1-3-4-7-19-12-14-35-26(16-19)37(36-15-13-24(38)30(29(36)31(35)39)42-18-43-32(40)41-2)28-20-10-11-23(33)27(34)22(20)17-44-25-9-6-5-8-21(25)28/h3-11,13,15,26,28H,12,14,16-18H2,1-2H3/b4-3-,19-7-/t26-,28?/m1/s1 |
| InChIKey | LHTOLSBTQXKGBB-FCINWDOZSA-N |
| XLogP | 5.66 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|