C33H26F2N4O6S — CID 163721651
[(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] [4-(methylideneamino)phenyl]methyl carbonate (PubChem CID 163721651) has the molecular formula C33H26F2N4O6S and a molecular weight of 644.66 g/mol. Its IUPAC name is [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] [4-(methylideneamino)phenyl]methyl carbonate.
| Compound Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] [4-(methylideneamino)phenyl]methyl carbonate |
|---|---|
| PubChem CID | 163721651 |
| Molecular Formula | C33H26F2N4O6S |
| Molecular Weight | 644.66 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | [(3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl] [4-(methylideneamino)phenyl]methyl carbonate |
| SMILES | C=Nc1ccc(COC(=O)Oc2c3n(ccc2=O)N([C@@H]2c4ccccc4SCc4c2ccc(F)c4F)[C@@H]2COCCN2C3=O)cc1 |
| InChI | InChI=1S/C33H26F2N4O6S/c1-36-20-8-6-19(7-9-20)16-44-33(42)45-31-25(40)12-13-38-30(31)32(41)37-14-15-43-17-27(37)39(38)29-21-10-11-24(34)28(35)23(21)18-46-26-5-3-2-4-22(26)29/h2-13,27,29H,1,14-18H2/t27-,29+/m1/s1 |
| InChIKey | KSCICOIZRHNDFB-PXJZQJOASA-N |
| XLogP | 5.32 |
| TPSA | 102.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|