C21H14F4O6 — CID 11848275
4-methoxy-7-methyl-9-[2-(2,3,5,6-tetrafluorophenoxy)ethoxy]furo[3,2-g]chromen-5-one (PubChem CID 11848275) has the molecular formula C21H14F4O6 and a molecular weight of 438.33 g/mol. Its IUPAC name is 4-methoxy-7-methyl-9-[2-(2,3,5,6-tetrafluorophenoxy)ethoxy]furo[3,2-g]chromen-5-one.
| Compound Name | 4-methoxy-7-methyl-9-[2-(2,3,5,6-tetrafluorophenoxy)ethoxy]furo[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 11848275 |
| Molecular Formula | C21H14F4O6 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-methoxy-7-methyl-9-[2-(2,3,5,6-tetrafluorophenoxy)ethoxy]furo[3,2-g]chromen-5-one |
| SMILES | COc1c2ccoc2c(OCCOc2c(F)c(F)cc(F)c2F)c2oc(C)cc(=O)c12 |
| InChI | InChI=1S/C21H14F4O6/c1-9-7-13(26)14-17(27-2)10-3-4-28-18(10)21(19(14)31-9)30-6-5-29-20-15(24)11(22)8-12(23)16(20)25/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | SEWFOWJQRNKNHS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|