C13H13NO4 — CID 153362053
ethane;4-methyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione (PubChem CID 153362053) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethane;4-methyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione.
| Compound Name | ethane;4-methyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione |
|---|---|
| PubChem CID | 153362053 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethane;4-methyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione |
| SMILES | CC.Cc1cc2c(=O)[nH]c(=O)c3ccoc3c2o1 |
| InChI | InChI=1S/C11H7NO4.C2H6/c1-5-4-7-9(16-5)8-6(2-3-15-8)10(13)12-11(7)14;1-2/h2-4H,1H3,(H,12,13,14);1-2H3 |
| InChIKey | ROKJUNONJCUXCS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |