C8H7NO2 — CID 143293213
5-methyl-6H-furo[2,3-c]pyridin-7-one (PubChem CID 143293213) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-methyl-6H-furo[2,3-c]pyridin-7-one.
| Compound Name | 5-methyl-6H-furo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 143293213 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 5-methyl-6H-furo[2,3-c]pyridin-7-one |
| SMILES | Cc1cc2ccoc2c(=O)[nH]1 |
| InChI | InChI=1S/C8H7NO2/c1-5-4-6-2-3-11-7(6)8(10)9-5/h2-4H,1H3,(H,9,10) |
| InChIKey | GDZFQXWJXRUXLE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |