About 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one
2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 74888895) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| PubChem CID | 74888895 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cc1cc2cc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C8H8N2O/c1-5-4-6-2-3-9-8(11)7(6)10-5/h2-4,10H,1H3,(H,9,11) |
| InChIKey | CQEACWYFDQQSTB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The IUPAC name of 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (CID 74888895) is 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
What is the SMILES notation for 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The canonical SMILES for 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one is Cc1cc2cc[nH]c(=O)c2[nH]1.
What is the InChIKey of 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
The InChIKey is CQEACWYFDQQSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-5-4-6-2-3-9-8(11)7(6)10-5/h2-4,10H,1H3,(H,9,11).
What are the key properties of 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one?
2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one has a molecular weight of 148.16 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,6-dihydropyrrolo[2,3-c]pyridin-7-one is sourced from PubChem (CID 74888895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).