C11H15N3O — CID 143841168
8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane (PubChem CID 143841168) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane.
| Compound Name | 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane |
|---|---|
| PubChem CID | 143841168 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane |
| SMILES | CC.Cc1cc2cc[nH]c(=O)c2c(N)n1 |
| InChI | InChI=1S/C9H9N3O.C2H6/c1-5-4-6-2-3-11-9(13)7(6)8(10)12-5;1-2/h2-4H,1H3,(H2,10,12)(H,11,13);1-2H3 |
| InChIKey | YZMIOLNARJNMPJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |