About 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane
8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane (PubChem CID 143841168) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane.
Molecular Properties
| Compound Name | 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane |
| PubChem CID | 143841168 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane |
| SMILES | CC.Cc1cc2cc[nH]c(=O)c2c(N)n1 |
| InChI | InChI=1S/C9H9N3O.C2H6/c1-5-4-6-2-3-11-9(13)7(6)8(10)12-5;1-2/h2-4H,1H3,(H2,10,12)(H,11,13);1-2H3 |
| InChIKey | YZMIOLNARJNMPJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane?
The IUPAC name of 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane (CID 143841168) is 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane.
What is the SMILES notation for 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane?
The canonical SMILES for 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane is CC.Cc1cc2cc[nH]c(=O)c2c(N)n1.
What is the InChIKey of 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane?
The InChIKey is YZMIOLNARJNMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O.C2H6/c1-5-4-6-2-3-11-9(13)7(6)8(10)12-5;1-2/h2-4H,1H3,(H2,10,12)(H,11,13);1-2H3.
What are the key properties of 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane?
8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane has a molecular weight of 205.26 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-6-methyl-2H-2,7-naphthyridin-1-one;ethane is sourced from PubChem (CID 143841168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).